| //===- LazyCallGraph.cpp - Analysis of a Module's call graph --------------===// |
| // |
| // Part of the LLVM Project, under the Apache License v2.0 with LLVM Exceptions. |
| // See https://llvm.org/LICENSE.txt for license information. |
| // SPDX-License-Identifier: Apache-2.0 WITH LLVM-exception |
| // |
| //===----------------------------------------------------------------------===// |
| |
| #include "llvm/Analysis/LazyCallGraph.h" |
| |
| #include "llvm/ADT/ArrayRef.h" |
| #include "llvm/ADT/STLExtras.h" |
| #include "llvm/ADT/Sequence.h" |
| #include "llvm/ADT/SmallPtrSet.h" |
| #include "llvm/ADT/SmallVector.h" |
| #include "llvm/ADT/iterator_range.h" |
| #include "llvm/Analysis/TargetLibraryInfo.h" |
| #include "llvm/IR/Constants.h" |
| #include "llvm/IR/Function.h" |
| #include "llvm/IR/GlobalVariable.h" |
| #include "llvm/IR/InstIterator.h" |
| #include "llvm/IR/Instruction.h" |
| #include "llvm/IR/Module.h" |
| #include "llvm/IR/PassManager.h" |
| #include "llvm/Support/Casting.h" |
| #include "llvm/Support/Compiler.h" |
| #include "llvm/Support/Debug.h" |
| #include "llvm/Support/GraphWriter.h" |
| #include "llvm/Support/raw_ostream.h" |
| #include <algorithm> |
| |
| #ifdef EXPENSIVE_CHECKS |
| #include "llvm/ADT/ScopeExit.h" |
| #endif |
| |
| using namespace llvm; |
| |
| #define DEBUG_TYPE "lcg" |
| |
| template struct LLVM_EXPORT_TEMPLATE Any::TypeId<const LazyCallGraph::SCC *>; |
| |
| void LazyCallGraph::EdgeSequence::insertEdgeInternal(Node &TargetN, |
| Edge::Kind EK) { |
| EdgeIndexMap.try_emplace(&TargetN, Edges.size()); |
| Edges.emplace_back(TargetN, EK); |
| } |
| |
| void LazyCallGraph::EdgeSequence::setEdgeKind(Node &TargetN, Edge::Kind EK) { |
| Edges[EdgeIndexMap.find(&TargetN)->second].setKind(EK); |
| } |
| |
| bool LazyCallGraph::EdgeSequence::removeEdgeInternal(Node &TargetN) { |
| auto IndexMapI = EdgeIndexMap.find(&TargetN); |
| if (IndexMapI == EdgeIndexMap.end()) |
| return false; |
| |
| Edges[IndexMapI->second] = Edge(); |
| EdgeIndexMap.erase(IndexMapI); |
| return true; |
| } |
| |
| static void addEdge(SmallVectorImpl<LazyCallGraph::Edge> &Edges, |
| DenseMap<LazyCallGraph::Node *, int> &EdgeIndexMap, |
| LazyCallGraph::Node &N, LazyCallGraph::Edge::Kind EK) { |
| if (!EdgeIndexMap.try_emplace(&N, Edges.size()).second) |
| return; |
| |
| LLVM_DEBUG(dbgs() << " Added callable function: " << N.getName() << "\n"); |
| Edges.emplace_back(LazyCallGraph::Edge(N, EK)); |
| } |
| |
| LazyCallGraph::EdgeSequence &LazyCallGraph::Node::populateSlow() { |
| assert(!Edges && "Must not have already populated the edges for this node!"); |
| |
| LLVM_DEBUG(dbgs() << " Adding functions called by '" << getName() |
| << "' to the graph.\n"); |
| |
| Edges = EdgeSequence(); |
| |
| SmallVector<Constant *, 16> Worklist; |
| SmallPtrSet<Function *, 4> Callees; |
| SmallPtrSet<Constant *, 16> Visited; |
| |
| // Find all the potential call graph edges in this function. We track both |
| // actual call edges and indirect references to functions. The direct calls |
| // are trivially added, but to accumulate the latter we walk the instructions |
| // and add every operand which is a constant to the worklist to process |
| // afterward. |
| // |
| // Note that we consider *any* function with a definition to be a viable |
| // edge. Even if the function's definition is subject to replacement by |
| // some other module (say, a weak definition) there may still be |
| // optimizations which essentially speculate based on the definition and |
| // a way to check that the specific definition is in fact the one being |
| // used. For example, this could be done by moving the weak definition to |
| // a strong (internal) definition and making the weak definition be an |
| // alias. Then a test of the address of the weak function against the new |
| // strong definition's address would be an effective way to determine the |
| // safety of optimizing a direct call edge. |
| for (BasicBlock &BB : *F) |
| for (Instruction &I : BB) { |
| if (auto *CB = dyn_cast<CallBase>(&I)) |
| if (Function *Callee = CB->getCalledFunction()) |
| if (!Callee->isDeclaration()) |
| if (Callees.insert(Callee).second) { |
| Visited.insert(Callee); |
| addEdge(Edges->Edges, Edges->EdgeIndexMap, G->get(*Callee), |
| LazyCallGraph::Edge::Call); |
| } |
| |
| for (Value *Op : I.operand_values()) |
| if (Constant *C = dyn_cast<Constant>(Op)) |
| if (Visited.insert(C).second) |
| Worklist.push_back(C); |
| } |
| |
| // We've collected all the constant (and thus potentially function or |
| // function containing) operands to all the instructions in the function. |
| // Process them (recursively) collecting every function found. |
| visitReferences(Worklist, Visited, [&](Function &F) { |
| addEdge(Edges->Edges, Edges->EdgeIndexMap, G->get(F), |
| LazyCallGraph::Edge::Ref); |
| }); |
| |
| // Add implicit reference edges to any defined libcall functions (if we |
| // haven't found an explicit edge). |
| for (auto *F : G->LibFunctions) |
| if (!Visited.count(F)) |
| addEdge(Edges->Edges, Edges->EdgeIndexMap, G->get(*F), |
| LazyCallGraph::Edge::Ref); |
| |
| return *Edges; |
| } |
| |
| void LazyCallGraph::Node::replaceFunction(Function &NewF) { |
| assert(F != &NewF && "Must not replace a function with itself!"); |
| F = &NewF; |
| } |
| |
| #if !defined(NDEBUG) || defined(LLVM_ENABLE_DUMP) |
| LLVM_DUMP_METHOD void LazyCallGraph::Node::dump() const { |
| dbgs() << *this << '\n'; |
| } |
| #endif |
| |
| static bool isKnownLibFunction(Function &F, TargetLibraryInfo &TLI) { |
| LibFunc LF; |
| |
| // Either this is a normal library function or a "vectorizable" |
| // function. Not using the VFDatabase here because this query |
| // is related only to libraries handled via the TLI. |
| return TLI.getLibFunc(F, LF) || |
| TLI.isKnownVectorFunctionInLibrary(F.getName()); |
| } |
| |
| LazyCallGraph::LazyCallGraph( |
| Module &M, function_ref<TargetLibraryInfo &(Function &)> GetTLI) { |
| LLVM_DEBUG(dbgs() << "Building CG for module: " << M.getModuleIdentifier() |
| << "\n"); |
| for (Function &F : M) { |
| if (F.isDeclaration()) |
| continue; |
| // If this function is a known lib function to LLVM then we want to |
| // synthesize reference edges to it to model the fact that LLVM can turn |
| // arbitrary code into a library function call. |
| if (isKnownLibFunction(F, GetTLI(F))) |
| LibFunctions.insert(&F); |
| |
| if (F.hasLocalLinkage()) |
| continue; |
| |
| // External linkage defined functions have edges to them from other |
| // modules. |
| LLVM_DEBUG(dbgs() << " Adding '" << F.getName() |
| << "' to entry set of the graph.\n"); |
| addEdge(EntryEdges.Edges, EntryEdges.EdgeIndexMap, get(F), Edge::Ref); |
| } |
| |
| // Externally visible aliases of internal functions are also viable entry |
| // edges to the module. |
| for (auto &A : M.aliases()) { |
| if (A.hasLocalLinkage()) |
| continue; |
| if (Function* F = dyn_cast<Function>(A.getAliasee())) { |
| LLVM_DEBUG(dbgs() << " Adding '" << F->getName() |
| << "' with alias '" << A.getName() |
| << "' to entry set of the graph.\n"); |
| addEdge(EntryEdges.Edges, EntryEdges.EdgeIndexMap, get(*F), Edge::Ref); |
| } |
| } |
| |
| // Now add entry nodes for functions reachable via initializers to globals. |
| SmallVector<Constant *, 16> Worklist; |
| SmallPtrSet<Constant *, 16> Visited; |
| for (GlobalVariable &GV : M.globals()) |
| if (GV.hasInitializer()) |
| if (Visited.insert(GV.getInitializer()).second) |
| Worklist.push_back(GV.getInitializer()); |
| |
| LLVM_DEBUG( |
| dbgs() << " Adding functions referenced by global initializers to the " |
| "entry set.\n"); |
| visitReferences(Worklist, Visited, [&](Function &F) { |
| addEdge(EntryEdges.Edges, EntryEdges.EdgeIndexMap, get(F), |
| LazyCallGraph::Edge::Ref); |
| }); |
| } |
| |
| LazyCallGraph::LazyCallGraph(LazyCallGraph &&G) |
| : BPA(std::move(G.BPA)), NodeMap(std::move(G.NodeMap)), |
| EntryEdges(std::move(G.EntryEdges)), SCCBPA(std::move(G.SCCBPA)), |
| SCCMap(std::move(G.SCCMap)), LibFunctions(std::move(G.LibFunctions)) { |
| updateGraphPtrs(); |
| } |
| |
| #if !defined(NDEBUG) || defined(EXPENSIVE_CHECKS) |
| void LazyCallGraph::verify() { |
| for (RefSCC &RC : postorder_ref_sccs()) { |
| RC.verify(); |
| } |
| } |
| #endif |
| |
| bool LazyCallGraph::invalidate(Module &, const PreservedAnalyses &PA, |
| ModuleAnalysisManager::Invalidator &) { |
| // Check whether the analysis, all analyses on functions, or the function's |
| // CFG have been preserved. |
| auto PAC = PA.getChecker<llvm::LazyCallGraphAnalysis>(); |
| return !(PAC.preserved() || PAC.preservedSet<AllAnalysesOn<Module>>()); |
| } |
| |
| LazyCallGraph &LazyCallGraph::operator=(LazyCallGraph &&G) { |
| BPA = std::move(G.BPA); |
| NodeMap = std::move(G.NodeMap); |
| EntryEdges = std::move(G.EntryEdges); |
| SCCBPA = std::move(G.SCCBPA); |
| SCCMap = std::move(G.SCCMap); |
| LibFunctions = std::move(G.LibFunctions); |
| updateGraphPtrs(); |
| return *this; |
| } |
| |
| #if !defined(NDEBUG) || defined(LLVM_ENABLE_DUMP) |
| LLVM_DUMP_METHOD void LazyCallGraph::SCC::dump() const { |
| dbgs() << *this << '\n'; |
| } |
| #endif |
| |
| #if !defined(NDEBUG) || defined(EXPENSIVE_CHECKS) |
| void LazyCallGraph::SCC::verify() { |
| assert(OuterRefSCC && "Can't have a null RefSCC!"); |
| assert(!Nodes.empty() && "Can't have an empty SCC!"); |
| |
| for (Node *N : Nodes) { |
| assert(N && "Can't have a null node!"); |
| assert(OuterRefSCC->G->lookupSCC(*N) == this && |
| "Node does not map to this SCC!"); |
| assert(N->DFSNumber == -1 && |
| "Must set DFS numbers to -1 when adding a node to an SCC!"); |
| assert(N->LowLink == -1 && |
| "Must set low link to -1 when adding a node to an SCC!"); |
| for (Edge &E : **N) |
| assert(E.getNode().isPopulated() && "Can't have an unpopulated node!"); |
| |
| #ifdef EXPENSIVE_CHECKS |
| // Verify that all nodes in this SCC can reach all other nodes. |
| SmallVector<Node *, 4> Worklist; |
| SmallPtrSet<Node *, 4> Visited; |
| Worklist.push_back(N); |
| while (!Worklist.empty()) { |
| Node *VisitingNode = Worklist.pop_back_val(); |
| if (!Visited.insert(VisitingNode).second) |
| continue; |
| for (Edge &E : (*VisitingNode)->calls()) |
| Worklist.push_back(&E.getNode()); |
| } |
| for (Node *NodeToVisit : Nodes) { |
| assert(Visited.contains(NodeToVisit) && |
| "Cannot reach all nodes within SCC"); |
| } |
| #endif |
| } |
| } |
| #endif |
| |
| bool LazyCallGraph::SCC::isParentOf(const SCC &C) const { |
| if (this == &C) |
| return false; |
| |
| for (Node &N : *this) |
| for (Edge &E : N->calls()) |
| if (OuterRefSCC->G->lookupSCC(E.getNode()) == &C) |
| return true; |
| |
| // No edges found. |
| return false; |
| } |
| |
| bool LazyCallGraph::SCC::isAncestorOf(const SCC &TargetC) const { |
| if (this == &TargetC) |
| return false; |
| |
| LazyCallGraph &G = *OuterRefSCC->G; |
| |
| // Start with this SCC. |
| SmallPtrSet<const SCC *, 16> Visited = {this}; |
| SmallVector<const SCC *, 16> Worklist = {this}; |
| |
| // Walk down the graph until we run out of edges or find a path to TargetC. |
| do { |
| const SCC &C = *Worklist.pop_back_val(); |
| for (Node &N : C) |
| for (Edge &E : N->calls()) { |
| SCC *CalleeC = G.lookupSCC(E.getNode()); |
| if (!CalleeC) |
| continue; |
| |
| // If the callee's SCC is the TargetC, we're done. |
| if (CalleeC == &TargetC) |
| return true; |
| |
| // If this is the first time we've reached this SCC, put it on the |
| // worklist to recurse through. |
| if (Visited.insert(CalleeC).second) |
| Worklist.push_back(CalleeC); |
| } |
| } while (!Worklist.empty()); |
| |
| // No paths found. |
| return false; |
| } |
| |
| LazyCallGraph::RefSCC::RefSCC(LazyCallGraph &G) : G(&G) {} |
| |
| #if !defined(NDEBUG) || defined(LLVM_ENABLE_DUMP) |
| LLVM_DUMP_METHOD void LazyCallGraph::RefSCC::dump() const { |
| dbgs() << *this << '\n'; |
| } |
| #endif |
| |
| #if !defined(NDEBUG) || defined(EXPENSIVE_CHECKS) |
| void LazyCallGraph::RefSCC::verify() { |
| assert(G && "Can't have a null graph!"); |
| assert(!SCCs.empty() && "Can't have an empty SCC!"); |
| |
| // Verify basic properties of the SCCs. |
| SmallPtrSet<SCC *, 4> SCCSet; |
| for (SCC *C : SCCs) { |
| assert(C && "Can't have a null SCC!"); |
| C->verify(); |
| assert(&C->getOuterRefSCC() == this && |
| "SCC doesn't think it is inside this RefSCC!"); |
| bool Inserted = SCCSet.insert(C).second; |
| assert(Inserted && "Found a duplicate SCC!"); |
| auto IndexIt = SCCIndices.find(C); |
| assert(IndexIt != SCCIndices.end() && |
| "Found an SCC that doesn't have an index!"); |
| } |
| |
| // Check that our indices map correctly. |
| for (auto [C, I] : SCCIndices) { |
| assert(C && "Can't have a null SCC in the indices!"); |
| assert(SCCSet.count(C) && "Found an index for an SCC not in the RefSCC!"); |
| assert(SCCs[I] == C && "Index doesn't point to SCC!"); |
| } |
| |
| // Check that the SCCs are in fact in post-order. |
| for (int I = 0, Size = SCCs.size(); I < Size; ++I) { |
| SCC &SourceSCC = *SCCs[I]; |
| for (Node &N : SourceSCC) |
| for (Edge &E : *N) { |
| if (!E.isCall()) |
| continue; |
| SCC &TargetSCC = *G->lookupSCC(E.getNode()); |
| if (&TargetSCC.getOuterRefSCC() == this) { |
| assert(SCCIndices.find(&TargetSCC)->second <= I && |
| "Edge between SCCs violates post-order relationship."); |
| continue; |
| } |
| } |
| } |
| |
| #ifdef EXPENSIVE_CHECKS |
| // Verify that all nodes in this RefSCC can reach all other nodes. |
| SmallVector<Node *> Nodes; |
| for (SCC *C : SCCs) { |
| for (Node &N : *C) |
| Nodes.push_back(&N); |
| } |
| for (Node *N : Nodes) { |
| SmallVector<Node *, 4> Worklist; |
| SmallPtrSet<Node *, 4> Visited; |
| Worklist.push_back(N); |
| while (!Worklist.empty()) { |
| Node *VisitingNode = Worklist.pop_back_val(); |
| if (!Visited.insert(VisitingNode).second) |
| continue; |
| for (Edge &E : **VisitingNode) |
| Worklist.push_back(&E.getNode()); |
| } |
| for (Node *NodeToVisit : Nodes) { |
| assert(Visited.contains(NodeToVisit) && |
| "Cannot reach all nodes within RefSCC"); |
| } |
| } |
| #endif |
| } |
| #endif |
| |
| bool LazyCallGraph::RefSCC::isParentOf(const RefSCC &RC) const { |
| if (&RC == this) |
| return false; |
| |
| // Search all edges to see if this is a parent. |
| for (SCC &C : *this) |
| for (Node &N : C) |
| for (Edge &E : *N) |
| if (G->lookupRefSCC(E.getNode()) == &RC) |
| return true; |
| |
| return false; |
| } |
| |
| bool LazyCallGraph::RefSCC::isAncestorOf(const RefSCC &RC) const { |
| if (&RC == this) |
| return false; |
| |
| // For each descendant of this RefSCC, see if one of its children is the |
| // argument. If not, add that descendant to the worklist and continue |
| // searching. |
| SmallVector<const RefSCC *, 4> Worklist; |
| SmallPtrSet<const RefSCC *, 4> Visited; |
| Worklist.push_back(this); |
| Visited.insert(this); |
| do { |
| const RefSCC &DescendantRC = *Worklist.pop_back_val(); |
| for (SCC &C : DescendantRC) |
| for (Node &N : C) |
| for (Edge &E : *N) { |
| auto *ChildRC = G->lookupRefSCC(E.getNode()); |
| if (ChildRC == &RC) |
| return true; |
| if (!ChildRC || !Visited.insert(ChildRC).second) |
| continue; |
| Worklist.push_back(ChildRC); |
| } |
| } while (!Worklist.empty()); |
| |
| return false; |
| } |
| |
| /// Generic helper that updates a postorder sequence of SCCs for a potentially |
| /// cycle-introducing edge insertion. |
| /// |
| /// A postorder sequence of SCCs of a directed graph has one fundamental |
| /// property: all deges in the DAG of SCCs point "up" the sequence. That is, |
| /// all edges in the SCC DAG point to prior SCCs in the sequence. |
| /// |
| /// This routine both updates a postorder sequence and uses that sequence to |
| /// compute the set of SCCs connected into a cycle. It should only be called to |
| /// insert a "downward" edge which will require changing the sequence to |
| /// restore it to a postorder. |
| /// |
| /// When inserting an edge from an earlier SCC to a later SCC in some postorder |
| /// sequence, all of the SCCs which may be impacted are in the closed range of |
| /// those two within the postorder sequence. The algorithm used here to restore |
| /// the state is as follows: |
| /// |
| /// 1) Starting from the source SCC, construct a set of SCCs which reach the |
| /// source SCC consisting of just the source SCC. Then scan toward the |
| /// target SCC in postorder and for each SCC, if it has an edge to an SCC |
| /// in the set, add it to the set. Otherwise, the source SCC is not |
| /// a successor, move it in the postorder sequence to immediately before |
| /// the source SCC, shifting the source SCC and all SCCs in the set one |
| /// position toward the target SCC. Stop scanning after processing the |
| /// target SCC. |
| /// 2) If the source SCC is now past the target SCC in the postorder sequence, |
| /// and thus the new edge will flow toward the start, we are done. |
| /// 3) Otherwise, starting from the target SCC, walk all edges which reach an |
| /// SCC between the source and the target, and add them to the set of |
| /// connected SCCs, then recurse through them. Once a complete set of the |
| /// SCCs the target connects to is known, hoist the remaining SCCs between |
| /// the source and the target to be above the target. Note that there is no |
| /// need to process the source SCC, it is already known to connect. |
| /// 4) At this point, all of the SCCs in the closed range between the source |
| /// SCC and the target SCC in the postorder sequence are connected, |
| /// including the target SCC and the source SCC. Inserting the edge from |
| /// the source SCC to the target SCC will form a cycle out of precisely |
| /// these SCCs. Thus we can merge all of the SCCs in this closed range into |
| /// a single SCC. |
| /// |
| /// This process has various important properties: |
| /// - Only mutates the SCCs when adding the edge actually changes the SCC |
| /// structure. |
| /// - Never mutates SCCs which are unaffected by the change. |
| /// - Updates the postorder sequence to correctly satisfy the postorder |
| /// constraint after the edge is inserted. |
| /// - Only reorders SCCs in the closed postorder sequence from the source to |
| /// the target, so easy to bound how much has changed even in the ordering. |
| /// - Big-O is the number of edges in the closed postorder range of SCCs from |
| /// source to target. |
| /// |
| /// This helper routine, in addition to updating the postorder sequence itself |
| /// will also update a map from SCCs to indices within that sequence. |
| /// |
| /// The sequence and the map must operate on pointers to the SCC type. |
| /// |
| /// Two callbacks must be provided. The first computes the subset of SCCs in |
| /// the postorder closed range from the source to the target which connect to |
| /// the source SCC via some (transitive) set of edges. The second computes the |
| /// subset of the same range which the target SCC connects to via some |
| /// (transitive) set of edges. Both callbacks should populate the set argument |
| /// provided. |
| template <typename SCCT, typename PostorderSequenceT, typename SCCIndexMapT, |
| typename ComputeSourceConnectedSetCallableT, |
| typename ComputeTargetConnectedSetCallableT> |
| static iterator_range<typename PostorderSequenceT::iterator> |
| updatePostorderSequenceForEdgeInsertion( |
| SCCT &SourceSCC, SCCT &TargetSCC, PostorderSequenceT &SCCs, |
| SCCIndexMapT &SCCIndices, |
| ComputeSourceConnectedSetCallableT ComputeSourceConnectedSet, |
| ComputeTargetConnectedSetCallableT ComputeTargetConnectedSet) { |
| int SourceIdx = SCCIndices[&SourceSCC]; |
| int TargetIdx = SCCIndices[&TargetSCC]; |
| assert(SourceIdx < TargetIdx && "Cannot have equal indices here!"); |
| |
| SmallPtrSet<SCCT *, 4> ConnectedSet; |
| |
| // Compute the SCCs which (transitively) reach the source. |
| ComputeSourceConnectedSet(ConnectedSet); |
| |
| // Partition the SCCs in this part of the port-order sequence so only SCCs |
| // connecting to the source remain between it and the target. This is |
| // a benign partition as it preserves postorder. |
| auto SourceI = std::stable_partition( |
| SCCs.begin() + SourceIdx, SCCs.begin() + TargetIdx + 1, |
| [&ConnectedSet](SCCT *C) { return !ConnectedSet.count(C); }); |
| for (int I = SourceIdx, E = TargetIdx + 1; I < E; ++I) |
| SCCIndices.find(SCCs[I])->second = I; |
| |
| // If the target doesn't connect to the source, then we've corrected the |
| // post-order and there are no cycles formed. |
| if (!ConnectedSet.count(&TargetSCC)) { |
| assert(SourceI > (SCCs.begin() + SourceIdx) && |
| "Must have moved the source to fix the post-order."); |
| assert(*std::prev(SourceI) == &TargetSCC && |
| "Last SCC to move should have bene the target."); |
| |
| // Return an empty range at the target SCC indicating there is nothing to |
| // merge. |
| return make_range(std::prev(SourceI), std::prev(SourceI)); |
| } |
| |
| assert(SCCs[TargetIdx] == &TargetSCC && |
| "Should not have moved target if connected!"); |
| SourceIdx = SourceI - SCCs.begin(); |
| assert(SCCs[SourceIdx] == &SourceSCC && |
| "Bad updated index computation for the source SCC!"); |
| |
| // See whether there are any remaining intervening SCCs between the source |
| // and target. If so we need to make sure they all are reachable form the |
| // target. |
| if (SourceIdx + 1 < TargetIdx) { |
| ConnectedSet.clear(); |
| ComputeTargetConnectedSet(ConnectedSet); |
| |
| // Partition SCCs so that only SCCs reached from the target remain between |
| // the source and the target. This preserves postorder. |
| auto TargetI = std::stable_partition( |
| SCCs.begin() + SourceIdx + 1, SCCs.begin() + TargetIdx + 1, |
| [&ConnectedSet](SCCT *C) { return ConnectedSet.count(C); }); |
| for (int I = SourceIdx + 1, E = TargetIdx + 1; I < E; ++I) |
| SCCIndices.find(SCCs[I])->second = I; |
| TargetIdx = std::prev(TargetI) - SCCs.begin(); |
| assert(SCCs[TargetIdx] == &TargetSCC && |
| "Should always end with the target!"); |
| } |
| |
| // At this point, we know that connecting source to target forms a cycle |
| // because target connects back to source, and we know that all the SCCs |
| // between the source and target in the postorder sequence participate in that |
| // cycle. |
| return make_range(SCCs.begin() + SourceIdx, SCCs.begin() + TargetIdx); |
| } |
| |
| bool LazyCallGraph::RefSCC::switchInternalEdgeToCall( |
| Node &SourceN, Node &TargetN, |
| function_ref<void(ArrayRef<SCC *> MergeSCCs)> MergeCB) { |
| assert(!(*SourceN)[TargetN].isCall() && "Must start with a ref edge!"); |
| SmallVector<SCC *, 1> DeletedSCCs; |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| llvm::scope_exit VerifyOnExit([&]() { verify(); }); |
| #endif |
| |
| SCC &SourceSCC = *G->lookupSCC(SourceN); |
| SCC &TargetSCC = *G->lookupSCC(TargetN); |
| |
| // If the two nodes are already part of the same SCC, we're also done as |
| // we've just added more connectivity. |
| if (&SourceSCC == &TargetSCC) { |
| SourceN->setEdgeKind(TargetN, Edge::Call); |
| return false; // No new cycle. |
| } |
| |
| // At this point we leverage the postorder list of SCCs to detect when the |
| // insertion of an edge changes the SCC structure in any way. |
| // |
| // First and foremost, we can eliminate the need for any changes when the |
| // edge is toward the beginning of the postorder sequence because all edges |
| // flow in that direction already. Thus adding a new one cannot form a cycle. |
| int SourceIdx = SCCIndices[&SourceSCC]; |
| int TargetIdx = SCCIndices[&TargetSCC]; |
| if (TargetIdx < SourceIdx) { |
| SourceN->setEdgeKind(TargetN, Edge::Call); |
| return false; // No new cycle. |
| } |
| |
| // Compute the SCCs which (transitively) reach the source. |
| auto ComputeSourceConnectedSet = [&](SmallPtrSetImpl<SCC *> &ConnectedSet) { |
| #ifdef EXPENSIVE_CHECKS |
| // Check that the RefSCC is still valid before computing this as the |
| // results will be nonsensical of we've broken its invariants. |
| verify(); |
| #endif |
| ConnectedSet.insert(&SourceSCC); |
| auto IsConnected = [&](SCC &C) { |
| for (Node &N : C) |
| for (Edge &E : N->calls()) |
| if (ConnectedSet.count(G->lookupSCC(E.getNode()))) |
| return true; |
| |
| return false; |
| }; |
| |
| for (SCC *C : |
| make_range(SCCs.begin() + SourceIdx + 1, SCCs.begin() + TargetIdx + 1)) |
| if (IsConnected(*C)) |
| ConnectedSet.insert(C); |
| }; |
| |
| // Use a normal worklist to find which SCCs the target connects to. We still |
| // bound the search based on the range in the postorder list we care about, |
| // but because this is forward connectivity we just "recurse" through the |
| // edges. |
| auto ComputeTargetConnectedSet = [&](SmallPtrSetImpl<SCC *> &ConnectedSet) { |
| #ifdef EXPENSIVE_CHECKS |
| // Check that the RefSCC is still valid before computing this as the |
| // results will be nonsensical of we've broken its invariants. |
| verify(); |
| #endif |
| ConnectedSet.insert(&TargetSCC); |
| SmallVector<SCC *, 4> Worklist; |
| Worklist.push_back(&TargetSCC); |
| do { |
| SCC &C = *Worklist.pop_back_val(); |
| for (Node &N : C) |
| for (Edge &E : *N) { |
| if (!E.isCall()) |
| continue; |
| SCC &EdgeC = *G->lookupSCC(E.getNode()); |
| if (&EdgeC.getOuterRefSCC() != this) |
| // Not in this RefSCC... |
| continue; |
| if (SCCIndices.find(&EdgeC)->second <= SourceIdx) |
| // Not in the postorder sequence between source and target. |
| continue; |
| |
| if (ConnectedSet.insert(&EdgeC).second) |
| Worklist.push_back(&EdgeC); |
| } |
| } while (!Worklist.empty()); |
| }; |
| |
| // Use a generic helper to update the postorder sequence of SCCs and return |
| // a range of any SCCs connected into a cycle by inserting this edge. This |
| // routine will also take care of updating the indices into the postorder |
| // sequence. |
| auto MergeRange = updatePostorderSequenceForEdgeInsertion( |
| SourceSCC, TargetSCC, SCCs, SCCIndices, ComputeSourceConnectedSet, |
| ComputeTargetConnectedSet); |
| |
| // Run the user's callback on the merged SCCs before we actually merge them. |
| if (MergeCB) |
| MergeCB(ArrayRef(MergeRange.begin(), MergeRange.end())); |
| |
| // If the merge range is empty, then adding the edge didn't actually form any |
| // new cycles. We're done. |
| if (MergeRange.empty()) { |
| // Now that the SCC structure is finalized, flip the kind to call. |
| SourceN->setEdgeKind(TargetN, Edge::Call); |
| return false; // No new cycle. |
| } |
| |
| #ifdef EXPENSIVE_CHECKS |
| // Before merging, check that the RefSCC remains valid after all the |
| // postorder updates. |
| verify(); |
| #endif |
| |
| // Otherwise we need to merge all the SCCs in the cycle into a single result |
| // SCC. |
| // |
| // NB: We merge into the target because all of these functions were already |
| // reachable from the target, meaning any SCC-wide properties deduced about it |
| // other than the set of functions within it will not have changed. |
| for (SCC *C : MergeRange) { |
| assert(C != &TargetSCC && |
| "We merge *into* the target and shouldn't process it here!"); |
| SCCIndices.erase(C); |
| TargetSCC.Nodes.append(C->Nodes.begin(), C->Nodes.end()); |
| for (Node *N : C->Nodes) |
| G->SCCMap[N] = &TargetSCC; |
| C->clear(); |
| DeletedSCCs.push_back(C); |
| } |
| |
| // Erase the merged SCCs from the list and update the indices of the |
| // remaining SCCs. |
| int IndexOffset = MergeRange.end() - MergeRange.begin(); |
| auto EraseEnd = SCCs.erase(MergeRange.begin(), MergeRange.end()); |
| for (SCC *C : make_range(EraseEnd, SCCs.end())) |
| SCCIndices[C] -= IndexOffset; |
| |
| // Now that the SCC structure is finalized, flip the kind to call. |
| SourceN->setEdgeKind(TargetN, Edge::Call); |
| |
| // And we're done, but we did form a new cycle. |
| return true; |
| } |
| |
| void LazyCallGraph::RefSCC::switchTrivialInternalEdgeToRef(Node &SourceN, |
| Node &TargetN) { |
| assert((*SourceN)[TargetN].isCall() && "Must start with a call edge!"); |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| llvm::scope_exit VerifyOnExit([&]() { verify(); }); |
| #endif |
| |
| assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC."); |
| assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC."); |
| assert(G->lookupSCC(SourceN) != G->lookupSCC(TargetN) && |
| "Source and Target must be in separate SCCs for this to be trivial!"); |
| |
| // Set the edge kind. |
| SourceN->setEdgeKind(TargetN, Edge::Ref); |
| } |
| |
| iterator_range<LazyCallGraph::RefSCC::iterator> |
| LazyCallGraph::RefSCC::switchInternalEdgeToRef(Node &SourceN, Node &TargetN) { |
| assert((*SourceN)[TargetN].isCall() && "Must start with a call edge!"); |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| llvm::scope_exit VerifyOnExit([&]() { verify(); }); |
| #endif |
| |
| assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC."); |
| assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC."); |
| |
| SCC &TargetSCC = *G->lookupSCC(TargetN); |
| assert(G->lookupSCC(SourceN) == &TargetSCC && "Source and Target must be in " |
| "the same SCC to require the " |
| "full CG update."); |
| |
| // Set the edge kind. |
| SourceN->setEdgeKind(TargetN, Edge::Ref); |
| |
| // Otherwise we are removing a call edge from a single SCC. This may break |
| // the cycle. In order to compute the new set of SCCs, we need to do a small |
| // DFS over the nodes within the SCC to form any sub-cycles that remain as |
| // distinct SCCs and compute a postorder over the resulting SCCs. |
| // |
| // However, we specially handle the target node. The target node is known to |
| // reach all other nodes in the original SCC by definition. This means that |
| // we want the old SCC to be replaced with an SCC containing that node as it |
| // will be the root of whatever SCC DAG results from the DFS. Assumptions |
| // about an SCC such as the set of functions called will continue to hold, |
| // etc. |
| |
| SCC &OldSCC = TargetSCC; |
| SmallVector<std::pair<Node *, EdgeSequence::call_iterator>, 16> DFSStack; |
| SmallVector<Node *, 16> PendingSCCStack; |
| SmallVector<SCC *, 4> NewSCCs; |
| |
| // Prepare the nodes for a fresh DFS. |
| SmallVector<Node *, 16> Worklist; |
| Worklist.swap(OldSCC.Nodes); |
| for (Node *N : Worklist) { |
| N->DFSNumber = N->LowLink = 0; |
| G->SCCMap.erase(N); |
| } |
| |
| // Force the target node to be in the old SCC. This also enables us to take |
| // a very significant short-cut in the standard Tarjan walk to re-form SCCs |
| // below: whenever we build an edge that reaches the target node, we know |
| // that the target node eventually connects back to all other nodes in our |
| // walk. As a consequence, we can detect and handle participants in that |
| // cycle without walking all the edges that form this connection, and instead |
| // by relying on the fundamental guarantee coming into this operation (all |
| // nodes are reachable from the target due to previously forming an SCC). |
| TargetN.DFSNumber = TargetN.LowLink = -1; |
| OldSCC.Nodes.push_back(&TargetN); |
| G->SCCMap[&TargetN] = &OldSCC; |
| |
| // Scan down the stack and DFS across the call edges. |
| for (Node *RootN : Worklist) { |
| assert(DFSStack.empty() && |
| "Cannot begin a new root with a non-empty DFS stack!"); |
| assert(PendingSCCStack.empty() && |
| "Cannot begin a new root with pending nodes for an SCC!"); |
| |
| // Skip any nodes we've already reached in the DFS. |
| if (RootN->DFSNumber != 0) { |
| assert(RootN->DFSNumber == -1 && |
| "Shouldn't have any mid-DFS root nodes!"); |
| continue; |
| } |
| |
| RootN->DFSNumber = RootN->LowLink = 1; |
| int NextDFSNumber = 2; |
| |
| DFSStack.emplace_back(RootN, (*RootN)->call_begin()); |
| do { |
| auto [N, I] = DFSStack.pop_back_val(); |
| auto E = (*N)->call_end(); |
| while (I != E) { |
| Node &ChildN = I->getNode(); |
| if (ChildN.DFSNumber == 0) { |
| // We haven't yet visited this child, so descend, pushing the current |
| // node onto the stack. |
| DFSStack.emplace_back(N, I); |
| |
| assert(!G->SCCMap.count(&ChildN) && |
| "Found a node with 0 DFS number but already in an SCC!"); |
| ChildN.DFSNumber = ChildN.LowLink = NextDFSNumber++; |
| N = &ChildN; |
| I = (*N)->call_begin(); |
| E = (*N)->call_end(); |
| continue; |
| } |
| |
| // Check for the child already being part of some component. |
| if (ChildN.DFSNumber == -1) { |
| if (G->lookupSCC(ChildN) == &OldSCC) { |
| // If the child is part of the old SCC, we know that it can reach |
| // every other node, so we have formed a cycle. Pull the entire DFS |
| // and pending stacks into it. See the comment above about setting |
| // up the old SCC for why we do this. |
| int OldSize = OldSCC.size(); |
| OldSCC.Nodes.push_back(N); |
| OldSCC.Nodes.append(PendingSCCStack.begin(), PendingSCCStack.end()); |
| PendingSCCStack.clear(); |
| while (!DFSStack.empty()) |
| OldSCC.Nodes.push_back(DFSStack.pop_back_val().first); |
| for (Node &N : drop_begin(OldSCC, OldSize)) { |
| N.DFSNumber = N.LowLink = -1; |
| G->SCCMap[&N] = &OldSCC; |
| } |
| N = nullptr; |
| break; |
| } |
| |
| // If the child has already been added to some child component, it |
| // couldn't impact the low-link of this parent because it isn't |
| // connected, and thus its low-link isn't relevant so skip it. |
| ++I; |
| continue; |
| } |
| |
| // Track the lowest linked child as the lowest link for this node. |
| assert(ChildN.LowLink > 0 && "Must have a positive low-link number!"); |
| if (ChildN.LowLink < N->LowLink) |
| N->LowLink = ChildN.LowLink; |
| |
| // Move to the next edge. |
| ++I; |
| } |
| if (!N) |
| // Cleared the DFS early, start another round. |
| break; |
| |
| // We've finished processing N and its descendants, put it on our pending |
| // SCC stack to eventually get merged into an SCC of nodes. |
| PendingSCCStack.push_back(N); |
| |
| // If this node is linked to some lower entry, continue walking up the |
| // stack. |
| if (N->LowLink != N->DFSNumber) |
| continue; |
| |
| // Otherwise, we've completed an SCC. Append it to our post order list of |
| // SCCs. |
| int RootDFSNumber = N->DFSNumber; |
| // Find the range of the node stack by walking down until we pass the |
| // root DFS number. |
| auto SCCNodes = make_range( |
| PendingSCCStack.rbegin(), |
| find_if(reverse(PendingSCCStack), [RootDFSNumber](const Node *N) { |
| return N->DFSNumber < RootDFSNumber; |
| })); |
| |
| // Form a new SCC out of these nodes and then clear them off our pending |
| // stack. |
| NewSCCs.push_back(G->createSCC(*this, SCCNodes)); |
| for (Node &N : *NewSCCs.back()) { |
| N.DFSNumber = N.LowLink = -1; |
| G->SCCMap[&N] = NewSCCs.back(); |
| } |
| PendingSCCStack.erase(SCCNodes.end().base(), PendingSCCStack.end()); |
| } while (!DFSStack.empty()); |
| } |
| |
| // Insert the remaining SCCs before the old one. The old SCC can reach all |
| // other SCCs we form because it contains the target node of the removed edge |
| // of the old SCC. This means that we will have edges into all the new SCCs, |
| // which means the old one must come last for postorder. |
| int OldIdx = SCCIndices[&OldSCC]; |
| SCCs.insert(SCCs.begin() + OldIdx, NewSCCs.begin(), NewSCCs.end()); |
| |
| // Update the mapping from SCC* to index to use the new SCC*s, and remove the |
| // old SCC from the mapping. |
| for (int Idx = OldIdx, Size = SCCs.size(); Idx < Size; ++Idx) |
| SCCIndices[SCCs[Idx]] = Idx; |
| |
| return make_range(SCCs.begin() + OldIdx, |
| SCCs.begin() + OldIdx + NewSCCs.size()); |
| } |
| |
| void LazyCallGraph::RefSCC::switchOutgoingEdgeToCall(Node &SourceN, |
| Node &TargetN) { |
| assert(!(*SourceN)[TargetN].isCall() && "Must start with a ref edge!"); |
| |
| assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC."); |
| assert(G->lookupRefSCC(TargetN) != this && |
| "Target must not be in this RefSCC."); |
| #ifdef EXPENSIVE_CHECKS |
| assert(G->lookupRefSCC(TargetN)->isDescendantOf(*this) && |
| "Target must be a descendant of the Source."); |
| #endif |
| |
| // Edges between RefSCCs are the same regardless of call or ref, so we can |
| // just flip the edge here. |
| SourceN->setEdgeKind(TargetN, Edge::Call); |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| #endif |
| } |
| |
| void LazyCallGraph::RefSCC::switchOutgoingEdgeToRef(Node &SourceN, |
| Node &TargetN) { |
| assert((*SourceN)[TargetN].isCall() && "Must start with a call edge!"); |
| |
| assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC."); |
| assert(G->lookupRefSCC(TargetN) != this && |
| "Target must not be in this RefSCC."); |
| #ifdef EXPENSIVE_CHECKS |
| assert(G->lookupRefSCC(TargetN)->isDescendantOf(*this) && |
| "Target must be a descendant of the Source."); |
| #endif |
| |
| // Edges between RefSCCs are the same regardless of call or ref, so we can |
| // just flip the edge here. |
| SourceN->setEdgeKind(TargetN, Edge::Ref); |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| #endif |
| } |
| |
| void LazyCallGraph::RefSCC::insertInternalRefEdge(Node &SourceN, |
| Node &TargetN) { |
| assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC."); |
| assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC."); |
| |
| SourceN->insertEdgeInternal(TargetN, Edge::Ref); |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| #endif |
| } |
| |
| void LazyCallGraph::RefSCC::insertOutgoingEdge(Node &SourceN, Node &TargetN, |
| Edge::Kind EK) { |
| // First insert it into the caller. |
| SourceN->insertEdgeInternal(TargetN, EK); |
| |
| assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC."); |
| |
| assert(G->lookupRefSCC(TargetN) != this && |
| "Target must not be in this RefSCC."); |
| #ifdef EXPENSIVE_CHECKS |
| assert(G->lookupRefSCC(TargetN)->isDescendantOf(*this) && |
| "Target must be a descendant of the Source."); |
| #endif |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| #endif |
| } |
| |
| SmallVector<LazyCallGraph::RefSCC *, 1> |
| LazyCallGraph::RefSCC::insertIncomingRefEdge(Node &SourceN, Node &TargetN) { |
| assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC."); |
| RefSCC &SourceC = *G->lookupRefSCC(SourceN); |
| assert(&SourceC != this && "Source must not be in this RefSCC."); |
| #ifdef EXPENSIVE_CHECKS |
| assert(SourceC.isDescendantOf(*this) && |
| "Source must be a descendant of the Target."); |
| #endif |
| |
| SmallVector<RefSCC *, 1> DeletedRefSCCs; |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| llvm::scope_exit VerifyOnExit([&]() { verify(); }); |
| #endif |
| |
| int SourceIdx = G->RefSCCIndices[&SourceC]; |
| int TargetIdx = G->RefSCCIndices[this]; |
| assert(SourceIdx < TargetIdx && |
| "Postorder list doesn't see edge as incoming!"); |
| |
| // Compute the RefSCCs which (transitively) reach the source. We do this by |
| // working backwards from the source using the parent set in each RefSCC, |
| // skipping any RefSCCs that don't fall in the postorder range. This has the |
| // advantage of walking the sparser parent edge (in high fan-out graphs) but |
| // more importantly this removes examining all forward edges in all RefSCCs |
| // within the postorder range which aren't in fact connected. Only connected |
| // RefSCCs (and their edges) are visited here. |
| auto ComputeSourceConnectedSet = [&](SmallPtrSetImpl<RefSCC *> &Set) { |
| Set.insert(&SourceC); |
| auto IsConnected = [&](RefSCC &RC) { |
| for (SCC &C : RC) |
| for (Node &N : C) |
| for (Edge &E : *N) |
| if (Set.count(G->lookupRefSCC(E.getNode()))) |
| return true; |
| |
| return false; |
| }; |
| |
| for (RefSCC *C : make_range(G->PostOrderRefSCCs.begin() + SourceIdx + 1, |
| G->PostOrderRefSCCs.begin() + TargetIdx + 1)) |
| if (IsConnected(*C)) |
| Set.insert(C); |
| }; |
| |
| // Use a normal worklist to find which SCCs the target connects to. We still |
| // bound the search based on the range in the postorder list we care about, |
| // but because this is forward connectivity we just "recurse" through the |
| // edges. |
| auto ComputeTargetConnectedSet = [&](SmallPtrSetImpl<RefSCC *> &Set) { |
| Set.insert(this); |
| SmallVector<RefSCC *, 4> Worklist; |
| Worklist.push_back(this); |
| do { |
| RefSCC &RC = *Worklist.pop_back_val(); |
| for (SCC &C : RC) |
| for (Node &N : C) |
| for (Edge &E : *N) { |
| RefSCC &EdgeRC = *G->lookupRefSCC(E.getNode()); |
| if (G->getRefSCCIndex(EdgeRC) <= SourceIdx) |
| // Not in the postorder sequence between source and target. |
| continue; |
| |
| if (Set.insert(&EdgeRC).second) |
| Worklist.push_back(&EdgeRC); |
| } |
| } while (!Worklist.empty()); |
| }; |
| |
| // Use a generic helper to update the postorder sequence of RefSCCs and return |
| // a range of any RefSCCs connected into a cycle by inserting this edge. This |
| // routine will also take care of updating the indices into the postorder |
| // sequence. |
| iterator_range<SmallVectorImpl<RefSCC *>::iterator> MergeRange = |
| updatePostorderSequenceForEdgeInsertion( |
| SourceC, *this, G->PostOrderRefSCCs, G->RefSCCIndices, |
| ComputeSourceConnectedSet, ComputeTargetConnectedSet); |
| |
| // Build a set, so we can do fast tests for whether a RefSCC will end up as |
| // part of the merged RefSCC. |
| SmallPtrSet<RefSCC *, 16> MergeSet(llvm::from_range, MergeRange); |
| |
| // This RefSCC will always be part of that set, so just insert it here. |
| MergeSet.insert(this); |
| |
| // Now that we have identified all the SCCs which need to be merged into |
| // a connected set with the inserted edge, merge all of them into this SCC. |
| SmallVector<SCC *, 16> MergedSCCs; |
| int SCCIndex = 0; |
| for (RefSCC *RC : MergeRange) { |
| assert(RC != this && "We're merging into the target RefSCC, so it " |
| "shouldn't be in the range."); |
| |
| // Walk the inner SCCs to update their up-pointer and walk all the edges to |
| // update any parent sets. |
| // FIXME: We should try to find a way to avoid this (rather expensive) edge |
| // walk by updating the parent sets in some other manner. |
| for (SCC &InnerC : *RC) { |
| InnerC.OuterRefSCC = this; |
| SCCIndices[&InnerC] = SCCIndex++; |
| for (Node &N : InnerC) |
| G->SCCMap[&N] = &InnerC; |
| } |
| |
| // Now merge in the SCCs. We can actually move here so try to reuse storage |
| // the first time through. |
| if (MergedSCCs.empty()) |
| MergedSCCs = std::move(RC->SCCs); |
| else |
| MergedSCCs.append(RC->SCCs.begin(), RC->SCCs.end()); |
| RC->SCCs.clear(); |
| DeletedRefSCCs.push_back(RC); |
| } |
| |
| // Append our original SCCs to the merged list and move it into place. |
| for (SCC &InnerC : *this) |
| SCCIndices[&InnerC] = SCCIndex++; |
| MergedSCCs.append(SCCs.begin(), SCCs.end()); |
| SCCs = std::move(MergedSCCs); |
| |
| // Remove the merged away RefSCCs from the post order sequence. |
| for (RefSCC *RC : MergeRange) |
| G->RefSCCIndices.erase(RC); |
| int IndexOffset = MergeRange.end() - MergeRange.begin(); |
| auto EraseEnd = |
| G->PostOrderRefSCCs.erase(MergeRange.begin(), MergeRange.end()); |
| for (RefSCC *RC : make_range(EraseEnd, G->PostOrderRefSCCs.end())) |
| G->RefSCCIndices[RC] -= IndexOffset; |
| |
| // At this point we have a merged RefSCC with a post-order SCCs list, just |
| // connect the nodes to form the new edge. |
| SourceN->insertEdgeInternal(TargetN, Edge::Ref); |
| |
| // We return the list of SCCs which were merged so that callers can |
| // invalidate any data they have associated with those SCCs. Note that these |
| // SCCs are no longer in an interesting state (they are totally empty) but |
| // the pointers will remain stable for the life of the graph itself. |
| return DeletedRefSCCs; |
| } |
| |
| void LazyCallGraph::RefSCC::removeOutgoingEdge(Node &SourceN, Node &TargetN) { |
| assert(G->lookupRefSCC(SourceN) == this && |
| "The source must be a member of this RefSCC."); |
| assert(G->lookupRefSCC(TargetN) != this && |
| "The target must not be a member of this RefSCC"); |
| |
| #ifdef EXPENSIVE_CHECKS |
| verify(); |
| llvm::scope_exit VerifyOnExit([&]() { verify(); }); |
| #endif |
| |
| // First remove it from the node. |
| bool Removed = SourceN->removeEdgeInternal(TargetN); |
| (void)Removed; |
| assert(Removed && "Target not in the edge set for this caller?"); |
| } |
| |
| SmallVector<LazyCallGraph::RefSCC *, 1> |
| LazyCallGraph::RefSCC::removeInternalRefEdges( |
| ArrayRef<std::pair<Node *, Node *>> Edges) { |
| // We return a list of the resulting *new* RefSCCs in post-order. |
| SmallVector<RefSCC *, 1> Result; |
| |
| #ifdef EXPENSIVE_CHECKS |
| // Verify the RefSCC is valid to start with and that either we return an empty |
| // list of result RefSCCs and this RefSCC remains valid, or we return new |
| // RefSCCs and this RefSCC is dead. |
| verify(); |
| llvm::scope_exit VerifyOnExit([&]() { |
| // If we didn't replace our RefSCC with new ones, check that this one |
| // remains valid. |
| if (G) |
| verify(); |
| }); |
| #endif |
| |
| // First remove the actual edges. |
| for (auto [SourceN, TargetN] : Edges) { |
| assert(!(**SourceN)[*TargetN].isCall() && |
| "Cannot remove a call edge, it must first be made a ref edge"); |
| |
| bool Removed = (*SourceN)->removeEdgeInternal(*TargetN); |
| (void)Removed; |
| assert(Removed && "Target not in the edge set for this caller?"); |
| } |
| |
| // Direct self references don't impact the ref graph at all. |
| // If all targets are in the same SCC as the source, because no call edges |
| // were removed there is no RefSCC structure change. |
| if (llvm::all_of(Edges, [&](std::pair<Node *, Node *> E) { |
| return E.first == E.second || |
| G->lookupSCC(*E.first) == G->lookupSCC(*E.second); |
| })) |
| return Result; |
| |
| // We build somewhat synthetic new RefSCCs by providing a postorder mapping |
| // for each inner SCC. We store these inside the low-link field of the nodes |
| // rather than associated with SCCs because this saves a round-trip through |
| // the node->SCC map and in the common case, SCCs are small. We will verify |
| // that we always give the same number to every node in the SCC such that |
| // these are equivalent. |
| int PostOrderNumber = 0; |
| |
| // Reset all the other nodes to prepare for a DFS over them, and add them to |
| // our worklist. |
| SmallVector<Node *, 8> Worklist; |
| for (SCC *C : SCCs) { |
| for (Node &N : *C) |
| N.DFSNumber = N.LowLink = 0; |
| |
| Worklist.append(C->Nodes.begin(), C->Nodes.end()); |
| } |
| |
| // Track the number of nodes in this RefSCC so that we can quickly recognize |
| // an important special case of the edge removal not breaking the cycle of |
| // this RefSCC. |
| const int NumRefSCCNodes = Worklist.size(); |
| |
| SmallVector<std::pair<Node *, EdgeSequence::iterator>, 4> DFSStack; |
| SmallVector<Node *, 4> PendingRefSCCStack; |
| do { |
| assert(DFSStack.empty() && |
| "Cannot begin a new root with a non-empty DFS stack!"); |
| assert(PendingRefSCCStack.empty() && |
| "Cannot begin a new root with pending nodes for an SCC!"); |
| |
| Node *RootN = Worklist.pop_back_val(); |
| // Skip any nodes we've already reached in the DFS. |
| if (RootN->DFSNumber != 0) { |
| assert(RootN->DFSNumber == -1 && |
| "Shouldn't have any mid-DFS root nodes!"); |
| continue; |
| } |
| |
| RootN->DFSNumber = RootN->LowLink = 1; |
| int NextDFSNumber = 2; |
| |
| DFSStack.emplace_back(RootN, (*RootN)->begin()); |
| do { |
| auto [N, I] = DFSStack.pop_back_val(); |
| auto E = (*N)->end(); |
| |
| assert(N->DFSNumber != 0 && "We should always assign a DFS number " |
| "before processing a node."); |
| |
| while (I != E) { |
| Node &ChildN = I->getNode(); |
| if (ChildN.DFSNumber == 0) { |
| // Mark that we should start at this child when next this node is the |
| // top of the stack. We don't start at the next child to ensure this |
| // child's lowlink is reflected. |
| DFSStack.emplace_back(N, I); |
| |
| // Continue, resetting to the child node. |
| ChildN.LowLink = ChildN.DFSNumber = NextDFSNumber++; |
| N = &ChildN; |
| I = ChildN->begin(); |
| E = ChildN->end(); |
| continue; |
| } |
| if (ChildN.DFSNumber == -1) { |
| // If this child isn't currently in this RefSCC, no need to process |
| // it. |
| ++I; |
| continue; |
| } |
| |
| // Track the lowest link of the children, if any are still in the stack. |
| // Any child not on the stack will have a LowLink of -1. |
| assert(ChildN.LowLink != 0 && |
| "Low-link must not be zero with a non-zero DFS number."); |
| if (ChildN.LowLink >= 0 && ChildN.LowLink < N->LowLink) |
| N->LowLink = ChildN.LowLink; |
| ++I; |
| } |
| |
| // We've finished processing N and its descendants, put it on our pending |
| // stack to eventually get merged into a RefSCC. |
| PendingRefSCCStack.push_back(N); |
| |
| // If this node is linked to some lower entry, continue walking up the |
| // stack. |
| if (N->LowLink != N->DFSNumber) { |
| assert(!DFSStack.empty() && |
| "We never found a viable root for a RefSCC to pop off!"); |
| continue; |
| } |
| |
| // Otherwise, form a new RefSCC from the top of the pending node stack. |
| int RefSCCNumber = PostOrderNumber++; |
| int RootDFSNumber = N->DFSNumber; |
| |
| // Find the range of the node stack by walking down until we pass the |
| // root DFS number. Update the DFS numbers and low link numbers in the |
| // process to avoid re-walking this list where possible. |
| auto StackRI = find_if(reverse(PendingRefSCCStack), [&](Node *N) { |
| if (N->DFSNumber < RootDFSNumber) |
| // We've found the bottom. |
| return true; |
| |
| // Update this node and keep scanning. |
| N->DFSNumber = -1; |
| // Save the post-order number in the lowlink field so that we can use |
| // it to map SCCs into new RefSCCs after we finish the DFS. |
| N->LowLink = RefSCCNumber; |
| return false; |
| }); |
| auto RefSCCNodes = make_range(StackRI.base(), PendingRefSCCStack.end()); |
| |
| // If we find a cycle containing all nodes originally in this RefSCC then |
| // the removal hasn't changed the structure at all. This is an important |
| // special case, and we can directly exit the entire routine more |
| // efficiently as soon as we discover it. |
| if (llvm::size(RefSCCNodes) == NumRefSCCNodes) { |
| // Clear out the low link field as we won't need it. |
| for (Node *N : RefSCCNodes) |
| N->LowLink = -1; |
| // Return the empty result immediately. |
| return Result; |
| } |
| |
| // We've already marked the nodes internally with the RefSCC number so |
| // just clear them off the stack and continue. |
| PendingRefSCCStack.erase(RefSCCNodes.begin(), PendingRefSCCStack.end()); |
| } while (!DFSStack.empty()); |
| |
| assert(DFSStack.empty() && "Didn't flush the entire DFS stack!"); |
| assert(PendingRefSCCStack.empty() && "Didn't flush all pending nodes!"); |
| } while (!Worklist.empty()); |
| |
| assert(PostOrderNumber > 1 && |
| "Should never finish the DFS when the existing RefSCC remains valid!"); |
| |
| // Otherwise we create a collection of new RefSCC nodes and build |
| // a radix-sort style map from postorder number to these new RefSCCs. We then |
| // append SCCs to each of these RefSCCs in the order they occurred in the |
| // original SCCs container. |
| for (int I = 0; I < PostOrderNumber; ++I) |
| Result.push_back(G->createRefSCC(*G)); |
| |
| // Insert the resulting postorder sequence into the global graph postorder |
| // sequence before the current RefSCC in that sequence, and then remove the |
| // current one. |
| // |
| // FIXME: It'd be nice to change the APIs so that we returned an iterator |
| // range over the global postorder sequence and generally use that sequence |
| // rather than building a separate result vector here. |
| int Idx = G->getRefSCCIndex(*this); |
| G->PostOrderRefSCCs.erase(G->PostOrderRefSCCs.begin() + Idx); |
| G->PostOrderRefSCCs.insert(G->PostOrderRefSCCs.begin() + Idx, Result.begin(), |
| Result.end()); |
| for (int I : seq<int>(Idx, G->PostOrderRefSCCs.size())) |
| G->RefSCCIndices[G->PostOrderRefSCCs[I]] = I; |
| |
| for (SCC *C : SCCs) { |
| // We store the SCC number in the node's low-link field above. |
| int SCCNumber = C->begin()->LowLink; |
| // Clear out all the SCC's node's low-link fields now that we're done |
| // using them as side-storage. |
| for (Node &N : *C) { |
| assert(N.LowLink == SCCNumber && |
| "Cannot have different numbers for nodes in the same SCC!"); |
| N.LowLink = -1; |
| } |
| |
| RefSCC &RC = *Result[SCCNumber]; |
| int SCCIndex = RC.SCCs.size(); |
| RC.SCCs.push_back(C); |
| RC.SCCIndices[C] = SCCIndex; |
| C->OuterRefSCC = &RC; |
| } |
| |
| // Now that we've moved things into the new RefSCCs, clear out our current |
| // one. |
| G = nullptr; |
| SCCs.clear(); |
| SCCIndices.clear(); |
| |
| #ifdef EXPENSIVE_CHECKS |
| // Verify the new RefSCCs we've built. |
| for (RefSCC *RC : Result) |
| RC->verify(); |
| #endif |
| |
| // Return the new list of SCCs. |
| return Result; |
| } |
| |
| void LazyCallGraph::RefSCC::insertTrivialCallEdge(Node &SourceN, |
| Node &TargetN) { |
| #ifdef EXPENSIVE_CHECKS |
| llvm::scope_exit ExitVerifier([this] { verify(); }); |
| |
| // Check that we aren't breaking some invariants of the SCC graph. Note that |
| // this is quadratic in the number of edges in the call graph! |
| SCC &SourceC = *G->lookupSCC(SourceN); |
| SCC &TargetC = *G->lookupSCC(TargetN); |
| if (&SourceC != &TargetC) |
| assert(SourceC.isAncestorOf(TargetC) && |
| "Call edge is not trivial in the SCC graph!"); |
| #endif |
| |
| // First insert it into the source or find the existing edge. |
| auto [Iterator, Inserted] = |
| SourceN->EdgeIndexMap.try_emplace(&TargetN, SourceN->Edges.size()); |
| if (!Inserted) { |
| // Already an edge, just update it. |
| Edge &E = SourceN->Edges[Iterator->second]; |
| if (E.isCall()) |
| return; // Nothing to do! |
| E.setKind(Edge::Call); |
| } else { |
| // Create the new edge. |
| SourceN->Edges.emplace_back(TargetN, Edge::Call); |
| } |
| } |
| |
| void LazyCallGraph::RefSCC::insertTrivialRefEdge(Node &SourceN, Node &TargetN) { |
| #ifdef EXPENSIVE_CHECKS |
| llvm::scope_exit ExitVerifier([this] { verify(); }); |
| |
| // Check that we aren't breaking some invariants of the RefSCC graph. |
| RefSCC &SourceRC = *G->lookupRefSCC(SourceN); |
| RefSCC &TargetRC = *G->lookupRefSCC(TargetN); |
| if (&SourceRC != &TargetRC) |
| assert(SourceRC.isAncestorOf(TargetRC) && |
| "Ref edge is not trivial in the RefSCC graph!"); |
| #endif |
| |
| // First insert it into the source or find the existing edge. |
| auto [Iterator, Inserted] = |
| SourceN->EdgeIndexMap.try_emplace(&TargetN, SourceN->Edges.size()); |
| (void)Iterator; |
| if (!Inserted) |
| // Already an edge, we're done. |
| return; |
| |
| // Create the new edge. |
| SourceN->Edges.emplace_back(TargetN, Edge::Ref); |
| } |
| |
| void LazyCallGraph::RefSCC::replaceNodeFunction(Node &N, Function &NewF) { |
| Function &OldF = N.getFunction(); |
| |
| #ifdef EXPENSIVE_CHECKS |
| llvm::scope_exit ExitVerifier([this] { verify(); }); |
| |
| assert(G->lookupRefSCC(N) == this && |
| "Cannot replace the function of a node outside this RefSCC."); |
| |
| assert(G->NodeMap.find(&NewF) == G->NodeMap.end() && |
| "Must not have already walked the new function!'"); |
| |
| // It is important that this replacement not introduce graph changes so we |
| // insist that the caller has already removed every use of the original |
| // function and that all uses of the new function correspond to existing |
| // edges in the graph. The common and expected way to use this is when |
| // replacing the function itself in the IR without changing the call graph |
| // shape and just updating the analysis based on that. |
| assert(&OldF != &NewF && "Cannot replace a function with itself!"); |
| assert(OldF.use_empty() && |
| "Must have moved all uses from the old function to the new!"); |
| #endif |
| |
| N.replaceFunction(NewF); |
| |
| // Update various call graph maps. |
| G->NodeMap.erase(&OldF); |
| G->NodeMap[&NewF] = &N; |
| |
| // Update lib functions. |
| if (G->isLibFunction(OldF)) { |
| G->LibFunctions.remove(&OldF); |
| G->LibFunctions.insert(&NewF); |
| } |
| } |
| |
| void LazyCallGraph::insertEdge(Node &SourceN, Node &TargetN, Edge::Kind EK) { |
| assert(SCCMap.empty() && |
| "This method cannot be called after SCCs have been formed!"); |
| |
| return SourceN->insertEdgeInternal(TargetN, EK); |
| } |
| |
| void LazyCallGraph::removeEdge(Node &SourceN, Node &TargetN) { |
| assert(SCCMap.empty() && |
| "This method cannot be called after SCCs have been formed!"); |
| |
| bool Removed = SourceN->removeEdgeInternal(TargetN); |
| (void)Removed; |
| assert(Removed && "Target not in the edge set for this caller?"); |
| } |
| |
| void LazyCallGraph::markDeadFunction(Function &F) { |
| // FIXME: This is unnecessarily restrictive. We should be able to remove |
| // functions which recursively call themselves. |
| assert(F.hasZeroLiveUses() && |
| "This routine should only be called on trivially dead functions!"); |
| |
| // We shouldn't remove library functions as they are never really dead while |
| // the call graph is in use -- every function definition refers to them. |
| assert(!isLibFunction(F) && |
| "Must not remove lib functions from the call graph!"); |
| |
| auto NI = NodeMap.find(&F); |
| assert(NI != NodeMap.end() && "Removed function should be known!"); |
| |
| Node &N = *NI->second; |
| |
| // Remove all call edges out of dead function. |
| for (Edge E : *N) { |
| if (E.isCall()) |
| N->setEdgeKind(E.getNode(), Edge::Ref); |
| } |
| } |
| |
| void LazyCallGraph::removeDeadFunctions(ArrayRef<Function *> DeadFs) { |
| if (DeadFs.empty()) |
| return; |
| |
| // Group dead functions by the RefSCC they're in. |
| DenseMap<RefSCC *, SmallVector<Node *, 1>> RCs; |
| for (Function *DeadF : DeadFs) { |
| Node *N = lookup(*DeadF); |
| #ifndef NDEBUG |
| for (Edge &E : **N) { |
| assert(!E.isCall() && |
| "dead function shouldn't have any outgoing call edges"); |
| } |
| #endif |
| RefSCC *RC = lookupRefSCC(*N); |
| RCs[RC].push_back(N); |
| } |
| // Remove outgoing edges from all dead functions. Dead functions should |
| // already have had their call edges removed in markDeadFunction(), so we only |
| // need to worry about spurious ref edges. |
| for (auto [RC, DeadNs] : RCs) { |
| SmallVector<std::pair<Node *, Node *>> InternalEdgesToRemove; |
| for (Node *DeadN : DeadNs) { |
| for (Edge &E : **DeadN) { |
| if (lookupRefSCC(E.getNode()) == RC) |
| InternalEdgesToRemove.push_back({DeadN, &E.getNode()}); |
| else |
| RC->removeOutgoingEdge(*DeadN, E.getNode()); |
| } |
| } |
| // We ignore the returned RefSCCs since at this point we're done with CGSCC |
| // iteration and don't need to add it to any worklists. |
| (void)RC->removeInternalRefEdges(InternalEdgesToRemove); |
| for (Node *DeadN : DeadNs) { |
| RefSCC *DeadRC = lookupRefSCC(*DeadN); |
| assert(DeadRC->size() == 1); |
| assert(DeadRC->begin()->size() == 1); |
| DeadRC->clear(); |
| DeadRC->G = nullptr; |
| } |
| } |
| // Clean up data structures. |
| for (Function *DeadF : DeadFs) { |
| Node &N = *lookup(*DeadF); |
| |
| EntryEdges.removeEdgeInternal(N); |
| SCCMap.erase(SCCMap.find(&N)); |
| NodeMap.erase(NodeMap.find(DeadF)); |
| |
| N.clear(); |
| N.G = nullptr; |
| N.F = nullptr; |
| } |
| } |
| |
| // Gets the Edge::Kind from one function to another by looking at the function's |
| // instructions. Asserts if there is no edge. |
| // Useful for determining what type of edge should exist between functions when |
| // the edge hasn't been created yet. |
| static LazyCallGraph::Edge::Kind getEdgeKind(Function &OriginalFunction, |
| Function &NewFunction) { |
| // In release builds, assume that if there are no direct calls to the new |
| // function, then there is a ref edge. In debug builds, keep track of |
| // references to assert that there is actually a ref edge if there is no call |
| // edge. |
| #ifndef NDEBUG |
| SmallVector<Constant *, 16> Worklist; |
| SmallPtrSet<Constant *, 16> Visited; |
| #endif |
| |
| for (Instruction &I : instructions(OriginalFunction)) { |
| if (auto *CB = dyn_cast<CallBase>(&I)) { |
| if (Function *Callee = CB->getCalledFunction()) { |
| if (Callee == &NewFunction) |
| return LazyCallGraph::Edge::Kind::Call; |
| } |
| } |
| #ifndef NDEBUG |
| for (Value *Op : I.operand_values()) { |
| if (Constant *C = dyn_cast<Constant>(Op)) { |
| if (Visited.insert(C).second) |
| Worklist.push_back(C); |
| } |
| } |
| #endif |
| } |
| |
| #ifndef NDEBUG |
| bool FoundNewFunction = false; |
| LazyCallGraph::visitReferences(Worklist, Visited, [&](Function &F) { |
| if (&F == &NewFunction) |
| FoundNewFunction = true; |
| }); |
| assert(FoundNewFunction && "No edge from original function to new function"); |
| #endif |
| |
| return LazyCallGraph::Edge::Kind::Ref; |
| } |
| |
| void LazyCallGraph::addSplitFunction(Function &OriginalFunction, |
| Function &NewFunction) { |
| assert(lookup(OriginalFunction) && |
| "Original function's node should already exist"); |
| Node &OriginalN = get(OriginalFunction); |
| SCC *OriginalC = lookupSCC(OriginalN); |
| RefSCC *OriginalRC = lookupRefSCC(OriginalN); |
| |
| #ifdef EXPENSIVE_CHECKS |
| OriginalRC->verify(); |
| llvm::scope_exit VerifyOnExit([&]() { OriginalRC->verify(); }); |
| #endif |
| |
| assert(!lookup(NewFunction) && |
| "New function's node should not already exist"); |
| Node &NewN = initNode(NewFunction); |
| |
| Edge::Kind EK = getEdgeKind(OriginalFunction, NewFunction); |
| |
| SCC *NewC = nullptr; |
| for (Edge &E : *NewN) { |
| Node &EN = E.getNode(); |
| if (EK == Edge::Kind::Call && E.isCall() && lookupSCC(EN) == OriginalC) { |
| // If the edge to the new function is a call edge and there is a call edge |
| // from the new function to any function in the original function's SCC, |
| // it is in the same SCC (and RefSCC) as the original function. |
| NewC = OriginalC; |
| NewC->Nodes.push_back(&NewN); |
| break; |
| } |
| } |
| |
| if (!NewC) { |
| for (Edge &E : *NewN) { |
| Node &EN = E.getNode(); |
| if (lookupRefSCC(EN) == OriginalRC) { |
| // If there is any edge from the new function to any function in the |
| // original function's RefSCC, it is in the same RefSCC as the original |
| // function but a new SCC. |
| RefSCC *NewRC = OriginalRC; |
| NewC = createSCC(*NewRC, SmallVector<Node *, 1>({&NewN})); |
| |
| // The new function's SCC is not the same as the original function's |
| // SCC, since that case was handled earlier. If the edge from the |
| // original function to the new function was a call edge, then we need |
| // to insert the newly created function's SCC before the original |
| // function's SCC. Otherwise, either the new SCC comes after the |
| // original function's SCC, or it doesn't matter, and in both cases we |
| // can add it to the very end. |
| int InsertIndex = EK == Edge::Kind::Call ? NewRC->SCCIndices[OriginalC] |
| : NewRC->SCCIndices.size(); |
| NewRC->SCCs.insert(NewRC->SCCs.begin() + InsertIndex, NewC); |
| for (int I = InsertIndex, Size = NewRC->SCCs.size(); I < Size; ++I) |
| NewRC->SCCIndices[NewRC->SCCs[I]] = I; |
| |
| break; |
| } |
| } |
| } |
| |
| if (!NewC) { |
| // We didn't find any edges back to the original function's RefSCC, so the |
| // new function belongs in a new RefSCC. The new RefSCC goes before the |
| // original function's RefSCC. |
| RefSCC *NewRC = createRefSCC(*this); |
| NewC = createSCC(*NewRC, SmallVector<Node *, 1>({&NewN})); |
| NewRC->SCCIndices[NewC] = 0; |
| NewRC->SCCs.push_back(NewC); |
| auto OriginalRCIndex = RefSCCIndices.find(OriginalRC)->second; |
| PostOrderRefSCCs.insert(PostOrderRefSCCs.begin() + OriginalRCIndex, NewRC); |
| for (int I = OriginalRCIndex, Size = PostOrderRefSCCs.size(); I < Size; ++I) |
| RefSCCIndices[PostOrderRefSCCs[I]] = I; |
| } |
| |
| SCCMap[&NewN] = NewC; |
| |
| OriginalN->insertEdgeInternal(NewN, EK); |
| } |
| |
| void LazyCallGraph::addSplitRefRecursiveFunctions( |
| Function &OriginalFunction, ArrayRef<Function *> NewFunctions) { |
| assert(!NewFunctions.empty() && "Can't add zero functions"); |
| assert(lookup(OriginalFunction) && |
| "Original function's node should already exist"); |
| Node &OriginalN = get(OriginalFunction); |
| RefSCC *OriginalRC = lookupRefSCC(OriginalN); |
| |
| #ifdef EXPENSIVE_CHECKS |
| OriginalRC->verify(); |
| llvm::scope_exit VerifyOnExit([&]() { |
| OriginalRC->verify(); |
| for (Function *NewFunction : NewFunctions) |
| lookupRefSCC(get(*NewFunction))->verify(); |
| }); |
| #endif |
| |
| bool ExistsRefToOriginalRefSCC = false; |
| |
| for (Function *NewFunction : NewFunctions) { |
| Node &NewN = initNode(*NewFunction); |
| |
| OriginalN->insertEdgeInternal(NewN, Edge::Kind::Ref); |
| |
| // Check if there is any edge from any new function back to any function in |
| // the original function's RefSCC. |
| for (Edge &E : *NewN) { |
| if (lookupRefSCC(E.getNode()) == OriginalRC) { |
| ExistsRefToOriginalRefSCC = true; |
| break; |
| } |
| } |
| } |
| |
| RefSCC *NewRC; |
| if (ExistsRefToOriginalRefSCC) { |
| // If there is any edge from any new function to any function in the |
| // original function's RefSCC, all new functions will be in the same RefSCC |
| // as the original function. |
| NewRC = OriginalRC; |
| } else { |
| // Otherwise the new functions are in their own RefSCC. |
| NewRC = createRefSCC(*this); |
| // The new RefSCC goes before the original function's RefSCC in postorder |
| // since there are only edges from the original function's RefSCC to the new |
| // RefSCC. |
| auto OriginalRCIndex = RefSCCIndices.find(OriginalRC)->second; |
| PostOrderRefSCCs.insert(PostOrderRefSCCs.begin() + OriginalRCIndex, NewRC); |
| for (int I = OriginalRCIndex, Size = PostOrderRefSCCs.size(); I < Size; ++I) |
| RefSCCIndices[PostOrderRefSCCs[I]] = I; |
| } |
| |
| for (Function *NewFunction : NewFunctions) { |
| Node &NewN = get(*NewFunction); |
| // Each new function is in its own new SCC. The original function can only |
| // have a ref edge to new functions, and no other existing functions can |
| // have references to new functions. Each new function only has a ref edge |
| // to the other new functions. |
| SCC *NewC = createSCC(*NewRC, SmallVector<Node *, 1>({&NewN})); |
| // The new SCCs are either sibling SCCs or parent SCCs to all other existing |
| // SCCs in the RefSCC. Either way, they can go at the back of the postorder |
| // SCC list. |
| auto Index = NewRC->SCCIndices.size(); |
| NewRC->SCCIndices[NewC] = Index; |
| NewRC->SCCs.push_back(NewC); |
| SCCMap[&NewN] = NewC; |
| } |
| |
| #ifndef NDEBUG |
| for (Function *F1 : NewFunctions) { |
| assert(getEdgeKind(OriginalFunction, *F1) == Edge::Kind::Ref && |
| "Expected ref edges from original function to every new function"); |
| Node &N1 = get(*F1); |
| for (Function *F2 : NewFunctions) { |
| if (F1 == F2) |
| continue; |
| Node &N2 = get(*F2); |
| assert(!N1->lookup(N2)->isCall() && |
| "Edges between new functions must be ref edges"); |
| } |
| } |
| #endif |
| } |
| |
| LazyCallGraph::Node &LazyCallGraph::insertInto(Function &F, Node *&MappedN) { |
| return *new (MappedN = BPA.Allocate()) Node(*this, F); |
| } |
| |
| void LazyCallGraph::updateGraphPtrs() { |
| // Walk the node map to update their graph pointers. While this iterates in |
| // an unstable order, the order has no effect, so it remains correct. |
| for (auto &FunctionNodePair : NodeMap) |
| FunctionNodePair.second->G = this; |
| |
| for (auto *RC : PostOrderRefSCCs) |
| RC->G = this; |
| } |
| |
| LazyCallGraph::Node &LazyCallGraph::initNode(Function &F) { |
| Node &N = get(F); |
| N.DFSNumber = N.LowLink = -1; |
| N.populate(); |
| NodeMap[&F] = &N; |
| return N; |
| } |
| |
| template <typename RootsT, typename GetBeginT, typename GetEndT, |
| typename GetNodeT, typename FormSCCCallbackT> |
| void LazyCallGraph::buildGenericSCCs(RootsT &&Roots, GetBeginT &&GetBegin, |
| GetEndT &&GetEnd, GetNodeT &&GetNode, |
| FormSCCCallbackT &&FormSCC) { |
| using EdgeItT = decltype(GetBegin(std::declval<Node &>())); |
| |
| SmallVector<std::pair<Node *, EdgeItT>, 16> DFSStack; |
| SmallVector<Node *, 16> PendingSCCStack; |
| |
| // Scan down the stack and DFS across the call edges. |
| for (Node *RootN : Roots) { |
| assert(DFSStack.empty() && |
| "Cannot begin a new root with a non-empty DFS stack!"); |
| assert(PendingSCCStack.empty() && |
| "Cannot begin a new root with pending nodes for an SCC!"); |
| |
| // Skip any nodes we've already reached in the DFS. |
| if (RootN->DFSNumber != 0) { |
| assert(RootN->DFSNumber == -1 && |
| "Shouldn't have any mid-DFS root nodes!"); |
| continue; |
| } |
| |
| RootN->DFSNumber = RootN->LowLink = 1; |
| int NextDFSNumber = 2; |
| |
| DFSStack.emplace_back(RootN, GetBegin(*RootN)); |
| do { |
| auto [N, I] = DFSStack.pop_back_val(); |
| auto E = GetEnd(*N); |
| while (I != E) { |
| Node &ChildN = GetNode(I); |
| if (ChildN.DFSNumber == 0) { |
| // We haven't yet visited this child, so descend, pushing the current |
| // node onto the stack. |
| DFSStack.emplace_back(N, I); |
| |
| ChildN.DFSNumber = ChildN.LowLink = NextDFSNumber++; |
| N = &ChildN; |
| I = GetBegin(*N); |
| E = GetEnd(*N); |
| continue; |
| } |
| |
| // If the child has already been added to some child component, it |
| // couldn't impact the low-link of this parent because it isn't |
| // connected, and thus its low-link isn't relevant so skip it. |
| if (ChildN.DFSNumber == -1) { |
| ++I; |
| continue; |
| } |
| |
| // Track the lowest linked child as the lowest link for this node. |
| assert(ChildN.LowLink > 0 && "Must have a positive low-link number!"); |
| if (ChildN.LowLink < N->LowLink) |
| N->LowLink = ChildN.LowLink; |
| |
| // Move to the next edge. |
| ++I; |
| } |
| |
| // We've finished processing N and its descendants, put it on our pending |
| // SCC stack to eventually get merged into an SCC of nodes. |
| PendingSCCStack.push_back(N); |
| |
| // If this node is linked to some lower entry, continue walking up the |
| // stack. |
| if (N->LowLink != N->DFSNumber) |
| continue; |
| |
| // Otherwise, we've completed an SCC. Append it to our post order list of |
| // SCCs. |
| int RootDFSNumber = N->DFSNumber; |
| // Find the range of the node stack by walking down until we pass the |
| // root DFS number. |
| auto SCCNodes = make_range( |
| PendingSCCStack.rbegin(), |
| find_if(reverse(PendingSCCStack), [RootDFSNumber](const Node *N) { |
| return N->DFSNumber < RootDFSNumber; |
| })); |
| // Form a new SCC out of these nodes and then clear them off our pending |
| // stack. |
| FormSCC(SCCNodes); |
| PendingSCCStack.erase(SCCNodes.end().base(), PendingSCCStack.end()); |
| } while (!DFSStack.empty()); |
| } |
| } |
| |
| /// Build the internal SCCs for a RefSCC from a sequence of nodes. |
| /// |
| /// Appends the SCCs to the provided vector and updates the map with their |
| /// indices. Both the vector and map must be empty when passed into this |
| /// routine. |
| void LazyCallGraph::buildSCCs(RefSCC &RC, node_stack_range Nodes) { |
| assert(RC.SCCs.empty() && "Already built SCCs!"); |
| assert(RC.SCCIndices.empty() && "Already mapped SCC indices!"); |
| |
| for (Node *N : Nodes) { |
| assert(N->LowLink >= (*Nodes.begin())->LowLink && |
| "We cannot have a low link in an SCC lower than its root on the " |
| "stack!"); |
| |
| // This node will go into the next RefSCC, clear out its DFS and low link |
| // as we scan. |
| N->DFSNumber = N->LowLink = 0; |
| } |
| |
| // Each RefSCC contains a DAG of the call SCCs. To build these, we do |
| // a direct walk of the call edges using Tarjan's algorithm. We reuse the |
| // internal storage as we won't need it for the outer graph's DFS any longer. |
| buildGenericSCCs( |
| Nodes, [](Node &N) { return N->call_begin(); }, |
| [](Node &N) { return N->call_end(); }, |
| [](EdgeSequence::call_iterator I) -> Node & { return I->getNode(); }, |
| [this, &RC](node_stack_range Nodes) { |
| RC.SCCs.push_back(createSCC(RC, Nodes)); |
| for (Node &N : *RC.SCCs.back()) { |
| N.DFSNumber = N.LowLink = -1; |
| SCCMap[&N] = RC.SCCs.back(); |
| } |
| }); |
| |
| // Wire up the SCC indices. |
| for (int I = 0, Size = RC.SCCs.size(); I < Size; ++I) |
| RC.SCCIndices[RC.SCCs[I]] = I; |
| } |
| |
| void LazyCallGraph::buildRefSCCs() { |
| if (EntryEdges.empty() || !PostOrderRefSCCs.empty()) |
| // RefSCCs are either non-existent or already built! |
| return; |
| |
| assert(RefSCCIndices.empty() && "Already mapped RefSCC indices!"); |
| |
| SmallVector<Node *, 16> Roots; |
| for (Edge &E : *this) |
| Roots.push_back(&E.getNode()); |
| |
| // The roots will be iterated in order. |
| buildGenericSCCs( |
| Roots, |
| [](Node &N) { |
| // We need to populate each node as we begin to walk its edges. |
| N.populate(); |
| return N->begin(); |
| }, |
| [](Node &N) { return N->end(); }, |
| [](EdgeSequence::iterator I) -> Node & { return I->getNode(); }, |
| [this](node_stack_range Nodes) { |
| RefSCC *NewRC = createRefSCC(*this); |
| buildSCCs(*NewRC, Nodes); |
| |
| // Push the new node into the postorder list and remember its position |
| // in the index map. |
| bool Inserted = |
| RefSCCIndices.try_emplace(NewRC, PostOrderRefSCCs.size()).second; |
| (void)Inserted; |
| assert(Inserted && "Cannot already have this RefSCC in the index map!"); |
| PostOrderRefSCCs.push_back(NewRC); |
| #ifdef EXPENSIVE_CHECKS |
| NewRC->verify(); |
| #endif |
| }); |
| } |
| |
| void LazyCallGraph::visitReferences(SmallVectorImpl<Constant *> &Worklist, |
| SmallPtrSetImpl<Constant *> &Visited, |
| function_ref<void(Function &)> Callback) { |
| while (!Worklist.empty()) { |
| Constant *C = Worklist.pop_back_val(); |
| |
| if (Function *F = dyn_cast<Function>(C)) { |
| if (!F->isDeclaration()) |
| Callback(*F); |
| continue; |
| } |
| |
| // blockaddresses are weird and don't participate in the call graph anyway, |
| // skip them. |
| if (isa<BlockAddress>(C)) |
| continue; |
| |
| for (Value *Op : C->operand_values()) |
| if (Visited.insert(cast<Constant>(Op)).second) |
| Worklist.push_back(cast<Constant>(Op)); |
| } |
| } |
| |
| AnalysisKey LazyCallGraphAnalysis::Key; |
| |
| LazyCallGraphPrinterPass::LazyCallGraphPrinterPass(raw_ostream &OS) : OS(OS) {} |
| |
| static void printNode(raw_ostream &OS, LazyCallGraph::Node &N) { |
| OS << " Edges in function: " << N.getFunction().getName() << "\n"; |
| for (LazyCallGraph::Edge &E : N.populate()) |
| OS << " " << (E.isCall() ? "call" : "ref ") << " -> " |
| << E.getFunction().getName() << "\n"; |
| |
| OS << "\n"; |
| } |
| |
| static void printSCC(raw_ostream &OS, LazyCallGraph::SCC &C) { |
| OS << " SCC with " << C.size() << " functions:\n"; |
| |
| for (LazyCallGraph::Node &N : C) |
| OS << " " << N.getFunction().getName() << "\n"; |
| } |
| |
| static void printRefSCC(raw_ostream &OS, LazyCallGraph::RefSCC &C) { |
| OS << " RefSCC with " << C.size() << " call SCCs:\n"; |
| |
| for (LazyCallGraph::SCC &InnerC : C) |
| printSCC(OS, InnerC); |
| |
| OS << "\n"; |
| } |
| |
| PreservedAnalyses LazyCallGraphPrinterPass::run(Module &M, |
| ModuleAnalysisManager &AM) { |
| LazyCallGraph &G = AM.getResult<LazyCallGraphAnalysis>(M); |
| |
| OS << "Printing the call graph for module: " << M.getModuleIdentifier() |
| << "\n\n"; |
| |
| for (Function &F : M) |
| printNode(OS, G.get(F)); |
| |
| G.buildRefSCCs(); |
| for (LazyCallGraph::RefSCC &C : G.postorder_ref_sccs()) |
| printRefSCC(OS, C); |
| |
| return PreservedAnalyses::all(); |
| } |
| |
| LazyCallGraphDOTPrinterPass::LazyCallGraphDOTPrinterPass(raw_ostream &OS) |
| : OS(OS) {} |
| |
| static void printNodeDOT(raw_ostream &OS, LazyCallGraph::Node &N) { |
| std::string Name = |
| "\"" + DOT::EscapeString(std::string(N.getFunction().getName())) + "\""; |
| |
| for (LazyCallGraph::Edge &E : N.populate()) { |
| OS << " " << Name << " -> \"" |
| << DOT::EscapeString(std::string(E.getFunction().getName())) << "\""; |
| if (!E.isCall()) // It is a ref edge. |
| OS << " [style=dashed,label=\"ref\"]"; |
| OS << ";\n"; |
| } |
| |
| OS << "\n"; |
| } |
| |
| PreservedAnalyses LazyCallGraphDOTPrinterPass::run(Module &M, |
| ModuleAnalysisManager &AM) { |
| LazyCallGraph &G = AM.getResult<LazyCallGraphAnalysis>(M); |
| |
| OS << "digraph \"" << DOT::EscapeString(M.getModuleIdentifier()) << "\" {\n"; |
| |
| for (Function &F : M) |
| printNodeDOT(OS, G.get(F)); |
| |
| OS << "}\n"; |
| |
| return PreservedAnalyses::all(); |
| } |